C15H24N2O2S2 — CID 10830161
ethyl 2-(diethylcarbamothioylamino)-4-propan-2-ylthiophene-3-carboxylate (PubChem CID 10830161) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is ethyl 2-(diethylcarbamothioylamino)-4-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(diethylcarbamothioylamino)-4-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 10830161 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 2-(diethylcarbamothioylamino)-4-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)C)csc1NC(=S)N(CC)CC |
| InChI | InChI=1S/C15H24N2O2S2/c1-6-17(7-2)15(20)16-13-12(14(18)19-8-3)11(9-21-13)10(4)5/h9-10H,6-8H2,1-5H3,(H,16,20) |
| InChIKey | AXBWKZDXJOSWFY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|