C13H21NO2S — CID 151803248
ethyl N-[3,4-di(propan-2-yl)thiophen-2-yl]carbamate (PubChem CID 151803248) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is ethyl N-[3,4-di(propan-2-yl)thiophen-2-yl]carbamate.
| Compound Name | ethyl N-[3,4-di(propan-2-yl)thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 151803248 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl N-[3,4-di(propan-2-yl)thiophen-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1scc(C(C)C)c1C(C)C |
| InChI | InChI=1S/C13H21NO2S/c1-6-16-13(15)14-12-11(9(4)5)10(7-17-12)8(2)3/h7-9H,6H2,1-5H3,(H,14,15) |
| InChIKey | RZBGFGSSZNCIAV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |