C15H23N7O2 — CID 10830479
6-[(2-aminoethylamino)methyl]-N-[2-(4-amino-1H-imidazol-5-yl)ethyl]-4-methoxypyridine-2-carboxamide (PubChem CID 10830479) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 6-[(2-aminoethylamino)methyl]-N-[2-(4-amino-1H-imidazol-5-yl)ethyl]-4-methoxypyridine-2-carboxamide.
| Compound Name | 6-[(2-aminoethylamino)methyl]-N-[2-(4-amino-1H-imidazol-5-yl)ethyl]-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 10830479 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 6-[(2-aminoethylamino)methyl]-N-[2-(4-amino-1H-imidazol-5-yl)ethyl]-4-methoxypyridine-2-carboxamide |
| SMILES | COc1cc(CNCCN)nc(C(=O)NCCc2[nH]cnc2N)c1 |
| InChI | InChI=1S/C15H23N7O2/c1-24-11-6-10(8-18-5-3-16)22-13(7-11)15(23)19-4-2-12-14(17)21-9-20-12/h6-7,9,18H,2-5,8,16-17H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | BWEJTJBPJVOQEW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|