C14H19N7O3 — CID 135439559
6-[(2-aminoethylamino)methyl]-N-[2-(5-nitro-1H-imidazol-4-yl)ethyl]pyridine-2-carboxamide (PubChem CID 135439559) has the molecular formula C14H19N7O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 6-[(2-aminoethylamino)methyl]-N-[2-(5-nitro-1H-imidazol-4-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-[(2-aminoethylamino)methyl]-N-[2-(5-nitro-1H-imidazol-4-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135439559 |
| Molecular Formula | C14H19N7O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-[(2-aminoethylamino)methyl]-N-[2-(5-nitro-1H-imidazol-4-yl)ethyl]pyridine-2-carboxamide |
| SMILES | NCCNCc1cccc(C(=O)NCCc2nc[nH]c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H19N7O3/c15-5-7-16-8-10-2-1-3-12(20-10)14(22)17-6-4-11-13(21(23)24)19-9-18-11/h1-3,9,16H,4-8,15H2,(H,17,22)(H,18,19) |
| InChIKey | FQFQJLKVHIHVEL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|