C23H26N6 — CID 10834051
4-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10834051) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10834051 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)c(Nc2nc(C)nc(NCCc3c[nH]c4ccccc34)n2)c(C)c1 |
| InChI | InChI=1S/C23H26N6/c1-14-11-15(2)21(16(3)12-14)28-23-27-17(4)26-22(29-23)24-10-9-18-13-25-20-8-6-5-7-19(18)20/h5-8,11-13,25H,9-10H2,1-4H3,(H2,24,26,27,28,29) |
| InChIKey | PULNDUWMGHPMNQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |