C31H64O6Si3 — CID 10841516
(2R,3S,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxane-2-carbaldehyde (PubChem CID 10841516) has the molecular formula C31H64O6Si3 and a molecular weight of 617.11 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxane-2-carbaldehyde.
| Compound Name | (2R,3S,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 10841516 |
| Molecular Formula | C31H64O6Si3 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | (2R,3S,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxane-2-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O[Si](CC)(CC)CC)CO[C@@H](C=O)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H64O6Si3/c1-12-38(13-2,14-3)35-25(11)24(10)29-27(34-29)21-26-23-33-28(22-32)31(37-40(18-7,19-8)20-9)30(26)36-39(15-4,16-5)17-6/h22,24-31H,12-21,23H2,1-11H3/t24-,25-,26-,27-,28-,29-,30+,31-/m0/s1 |
| InChIKey | CYXPMCWVMUERFW-LHVSEXAWSA-N |
| XLogP | 8.19 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|