C9H12BNO2 — CID 10845018
3-(1,3,2-benzodioxaborol-2-yl)propan-1-amine (PubChem CID 10845018) has the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. Its IUPAC name is 3-(1,3,2-benzodioxaborol-2-yl)propan-1-amine.
| Compound Name | 3-(1,3,2-benzodioxaborol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 10845018 |
| Molecular Formula | C9H12BNO2 |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-(1,3,2-benzodioxaborol-2-yl)propan-1-amine |
| SMILES | NCCCB1Oc2ccccc2O1 |
| InChI | InChI=1S/C9H12BNO2/c11-7-3-6-10-12-8-4-1-2-5-9(8)13-10/h1-2,4-5H,3,6-7,11H2 |
| InChIKey | GMZXWFVHSBFAEF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|