About 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one
2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one (PubChem CID 10845225) has the molecular formula C10H12F2O
and a molecular weight of 186.20 g/mol. Its IUPAC name is 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one.
Analyze 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one?
The IUPAC name of 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one (CID 10845225) is 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one.
What is the SMILES notation for 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one?
The canonical SMILES for 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one is O=C1C2=C(CCCC2)CCC1(F)F.
What is the InChIKey of 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one?
The InChIKey is CNXIFKAESSPBRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2O/c11-10(12)6-5-7-3-1-2-4-8(7)9(10)13/h1-6H2.
What are the key properties of 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one?
2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one has a molecular weight of 186.20 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3,4,5,6,7,8-hexahydronaphthalen-1-one is sourced from PubChem (CID 10845225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).