C11H10N2S — CID 10845795
2,8-dimethylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 10845795) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2,8-dimethylimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2,8-dimethylimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 10845795 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2,8-dimethylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1cn2c(n1)sc1cccc(C)c12 |
| InChI | InChI=1S/C11H10N2S/c1-7-4-3-5-9-10(7)13-6-8(2)12-11(13)14-9/h3-6H,1-2H3 |
| InChIKey | SWELCQLJVJMKPA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |