C14H11N3O3S — CID 1084680
N-(2-acetamido-1,3-benzothiazol-6-yl)furan-2-carboxamide (PubChem CID 1084680) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-6-yl)furan-2-carboxamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1084680 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-6-yl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1nc2ccc(NC(=O)c3ccco3)cc2s1 |
| InChI | InChI=1S/C14H11N3O3S/c1-8(18)15-14-17-10-5-4-9(7-12(10)21-14)16-13(19)11-3-2-6-20-11/h2-7H,1H3,(H,16,19)(H,15,17,18) |
| InChIKey | QWSVKKATFAPISN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |