C10H20NO6P — CID 10850384
(2R,3R,4R)-5-(diethoxyphosphorylmethyl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyrrole-3,4-diol (PubChem CID 10850384) has the molecular formula C10H20NO6P and a molecular weight of 281.25 g/mol. Its IUPAC name is (2R,3R,4R)-5-(diethoxyphosphorylmethyl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyrrole-3,4-diol.
| Compound Name | (2R,3R,4R)-5-(diethoxyphosphorylmethyl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyrrole-3,4-diol |
|---|---|
| PubChem CID | 10850384 |
| Molecular Formula | C10H20NO6P |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2R,3R,4R)-5-(diethoxyphosphorylmethyl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyrrole-3,4-diol |
| SMILES | CCOP(=O)(CC1=N[C@H](CO)[C@@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C10H20NO6P/c1-3-16-18(15,17-4-2)6-8-10(14)9(13)7(5-12)11-8/h7,9-10,12-14H,3-6H2,1-2H3/t7-,9-,10-/m1/s1 |
| InChIKey | UGPAKSWZRWZYJX-SZEHBUNVSA-N |
| XLogP | -0.21 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|