C9H16BaO6PSe — CID 166116427
CID 166116427 (PubChem CID 166116427) has the molecular formula C9H16BaO6PSe and a molecular weight of 467.48 g/mol.
| Compound Name | CID 166116427 |
|---|---|
| PubChem CID | 166116427 |
| Molecular Formula | C9H16BaO6PSe |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 468.89 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(COC1CC(=O)C([Se][Ba])O1)OCC |
| InChI | InChI=1S/C9H17O6PSe.Ba/c1-3-13-16(11,14-4-2)6-12-8-5-7(10)9(17)15-8;/h8-9,17H,3-6H2,1-2H3;/q;+1/p-1 |
| InChIKey | KNXUTRQXOLETNE-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|