C23H29N3O4S — CID 108510830
N-[2-(4-sulfamoylphenyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide (PubChem CID 108510830) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 108510830 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
| SMILES | CCC(NC(=O)C(=O)NCCc1ccc(S(N)(=O)=O)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H29N3O4S/c1-2-21(19-10-9-17-5-3-4-6-18(17)15-19)26-23(28)22(27)25-14-13-16-7-11-20(12-8-16)31(24,29)30/h7-12,15,21H,2-6,13-14H2,1H3,(H,25,27)(H,26,28)(H2,24,29,30) |
| InChIKey | JTMKLFBNXHDHBP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|