C18H24N2O4S — CID 108511244
N-(1,1-dioxothiolan-3-yl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide (PubChem CID 108511244) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511244 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)NC1CCS(=O)(=O)C1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H24N2O4S/c1-12(14-7-6-13-4-2-3-5-15(13)10-14)19-17(21)18(22)20-16-8-9-25(23,24)11-16/h6-7,10,12,16H,2-5,8-9,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | HBBCAFHKWYULLC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|