C13H17N3O4S — CID 108516871
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N',N'-bis(prop-2-enyl)oxamide (PubChem CID 108516871) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N',N'-bis(prop-2-enyl)oxamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N',N'-bis(prop-2-enyl)oxamide |
|---|---|
| PubChem CID | 108516871 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N',N'-bis(prop-2-enyl)oxamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C13H17N3O4S/c1-3-6-15(7-4-2)12(19)11(18)14-5-8-16-10(17)9-21-13(16)20/h3-4H,1-2,5-9H2,(H,14,18) |
| InChIKey | MJBQYLQYDCABAN-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|