C13H15N5O2 — CID 108519107
N'-benzyl-N'-ethyl-N-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519107) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-N-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N'-benzyl-N'-ethyl-N-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519107 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N'-benzyl-N'-ethyl-N-(1,2,4-triazol-4-yl)oxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-17(8-11-6-4-3-5-7-11)13(20)12(19)16-18-9-14-15-10-18/h3-7,9-10H,2,8H2,1H3,(H,16,19) |
| InChIKey | DGNTWHYTOLYMNX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|