C14H19ClN2O4 — CID 108526393
N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(1-hydroxybutan-2-yl)oxamide (PubChem CID 108526393) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526393 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)Nc1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-4-9(7-18)16-13(19)14(20)17-11-5-8(2)10(15)6-12(11)21-3/h5-6,9,18H,4,7H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | XZEFYKJGUKLDIC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|