C13H18N4O4S2 — CID 108526822
N-(1,1-dioxothiolan-3-yl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide (PubChem CID 108526822) has the molecular formula C13H18N4O4S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
|---|---|
| PubChem CID | 108526822 |
| Molecular Formula | C13H18N4O4S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
| SMILES | CN1CCc2nc(NC(=O)C(=O)NC3CCS(=O)(=O)C3)sc2C1 |
| InChI | InChI=1S/C13H18N4O4S2/c1-17-4-2-9-10(6-17)22-13(15-9)16-12(19)11(18)14-8-3-5-23(20,21)7-8/h8H,2-7H2,1H3,(H,14,18)(H,15,16,19) |
| InChIKey | LQOJPMQFPQNIJN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|