C19H21N3O5 — CID 108531126
N-(2-ethoxyphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108531126) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108531126 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H21N3O5/c1-2-26-15-7-4-3-6-14(15)20-17(23)19(25)22-11-9-21(10-12-22)18(24)16-8-5-13-27-16/h3-8,13H,2,9-12H2,1H3,(H,20,23) |
| InChIKey | IZMRSSIJHYKKHY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|