C20H25ClN2O3 — CID 108531425
N'-(1-adamantyl)-N-(4-chloro-2-methoxy-5-methylphenyl)oxamide (PubChem CID 108531425) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is N'-(1-adamantyl)-N-(4-chloro-2-methoxy-5-methylphenyl)oxamide.
| Compound Name | N'-(1-adamantyl)-N-(4-chloro-2-methoxy-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108531425 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N'-(1-adamantyl)-N-(4-chloro-2-methoxy-5-methylphenyl)oxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25ClN2O3/c1-11-3-16(17(26-2)7-15(11)21)22-18(24)19(25)23-20-8-12-4-13(9-20)6-14(5-12)10-20/h3,7,12-14H,4-6,8-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | RACHOGXWHKUZHA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|