C19H16Cl2O — CID 10853949
4-(2,4-dichloro-3-methylphenyl)-2,6-dimethylnaphthalen-1-ol (PubChem CID 10853949) has the molecular formula C19H16Cl2O and a molecular weight of 331.24 g/mol. Its IUPAC name is 4-(2,4-dichloro-3-methylphenyl)-2,6-dimethylnaphthalen-1-ol.
| Compound Name | 4-(2,4-dichloro-3-methylphenyl)-2,6-dimethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 10853949 |
| Molecular Formula | C19H16Cl2O |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-(2,4-dichloro-3-methylphenyl)-2,6-dimethylnaphthalen-1-ol |
| SMILES | Cc1ccc2c(O)c(C)cc(-c3ccc(Cl)c(C)c3Cl)c2c1 |
| InChI | InChI=1S/C19H16Cl2O/c1-10-4-5-14-15(8-10)16(9-11(2)19(14)22)13-6-7-17(20)12(3)18(13)21/h4-9,22H,1-3H3 |
| InChIKey | QBNPUVRIBGJBMN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |