C20H23ClN2O5 — CID 108540827
5-chloro-N-[2-[[2-(2-ethoxyphenoxy)acetyl]amino]ethyl]-2-methoxybenzamide (PubChem CID 108540827) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is 5-chloro-N-[2-[[2-(2-ethoxyphenoxy)acetyl]amino]ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[[2-(2-ethoxyphenoxy)acetyl]amino]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108540827 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 5-chloro-N-[2-[[2-(2-ethoxyphenoxy)acetyl]amino]ethyl]-2-methoxybenzamide |
| SMILES | CCOc1ccccc1OCC(=O)NCCNC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C20H23ClN2O5/c1-3-27-17-6-4-5-7-18(17)28-13-19(24)22-10-11-23-20(25)15-12-14(21)8-9-16(15)26-2/h4-9,12H,3,10-11,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | MJJQKSHIWQHDCL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|