C19H20Cl2N2O3 — CID 108542215
2,5-dichloro-N-[2-[[2-(2-ethylphenoxy)acetyl]amino]ethyl]benzamide (PubChem CID 108542215) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[2-(2-ethylphenoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[2-(2-ethylphenoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108542215 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2,5-dichloro-N-[2-[[2-(2-ethylphenoxy)acetyl]amino]ethyl]benzamide |
| SMILES | CCc1ccccc1OCC(=O)NCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-2-13-5-3-4-6-17(13)26-12-18(24)22-9-10-23-19(25)15-11-14(20)7-8-16(15)21/h3-8,11H,2,9-10,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | VWYVVPMTRVYIDC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|