About CID 10856570
CID 10856570 (PubChem CID 10856570) has the molecular formula C13H17Si
and a molecular weight of 201.37 g/mol.
Molecular Properties
| Compound Name | CID 10856570 |
| PubChem CID | 10856570 |
| Molecular Formula | C13H17Si |
| Molecular Weight | 201.37 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | — |
| SMILES | CCCCC#C[Si](C)c1ccccc1 |
| InChI | InChI=1S/C13H17Si/c1-3-4-5-9-12-14(2)13-10-7-6-8-11-13/h6-8,10-11H,3-5H2,1-2H3 |
| InChIKey | GPQGWJUJKJPEGM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 10856570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10856570?
The IUPAC name of CID 10856570 (CID 10856570) is not available.
What is the SMILES notation for CID 10856570?
The canonical SMILES for CID 10856570 is CCCCC#C[Si](C)c1ccccc1.
What is the InChIKey of CID 10856570?
The InChIKey is GPQGWJUJKJPEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Si/c1-3-4-5-9-12-14(2)13-10-7-6-8-11-13/h6-8,10-11H,3-5H2,1-2H3.
What are the key properties of CID 10856570?
CID 10856570 has a molecular weight of 201.37 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10856570 is sourced from PubChem (CID 10856570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).