C17H21ClN2O4 — CID 108569973
1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-chloro-2,2-dimethylpropan-1-one (PubChem CID 108569973) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-chloro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-chloro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 108569973 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-chloro-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H21ClN2O4/c1-17(2,10-18)16(22)20-7-5-19(6-8-20)15(21)12-3-4-13-14(9-12)24-11-23-13/h3-4,9H,5-8,10-11H2,1-2H3 |
| InChIKey | ONYWOKPSEQUSQW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|