C19H20O3 — CID 10859424
(1S,2R,6S,7S)-5-(dicyclopropylmethylidene)-1-methoxytricyclo[5.2.2.02,6]undeca-3,10-diene-8,9-dione (PubChem CID 10859424) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1S,2R,6S,7S)-5-(dicyclopropylmethylidene)-1-methoxytricyclo[5.2.2.02,6]undeca-3,10-diene-8,9-dione.
| Compound Name | (1S,2R,6S,7S)-5-(dicyclopropylmethylidene)-1-methoxytricyclo[5.2.2.02,6]undeca-3,10-diene-8,9-dione |
|---|---|
| PubChem CID | 10859424 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1S,2R,6S,7S)-5-(dicyclopropylmethylidene)-1-methoxytricyclo[5.2.2.02,6]undeca-3,10-diene-8,9-dione |
| SMILES | CO[C@]12C=C[C@H](C(=O)C1=O)[C@H]1C(=C(C3CC3)C3CC3)C=C[C@H]12 |
| InChI | InChI=1S/C19H20O3/c1-22-19-9-8-13(17(20)18(19)21)16-12(6-7-14(16)19)15(10-2-3-10)11-4-5-11/h6-11,13-14,16H,2-5H2,1H3/t13-,14+,16+,19-/m0/s1 |
| InChIKey | JWLALTXPEZTUJI-ZDXGLAPJSA-N |
| XLogP | 2.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|