C17H27NO6 — CID 10860776
tert-butyl (3aS,4R,6aR)-4-[(E)-4-methoxy-4-oxobut-1-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 10860776) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is tert-butyl (3aS,4R,6aR)-4-[(E)-4-methoxy-4-oxobut-1-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4R,6aR)-4-[(E)-4-methoxy-4-oxobut-1-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 10860776 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | tert-butyl (3aS,4R,6aR)-4-[(E)-4-methoxy-4-oxobut-1-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)C/C=C/[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO6/c1-16(2,3)24-15(20)18-10-12-14(23-17(4,5)22-12)11(18)8-7-9-13(19)21-6/h7-8,11-12,14H,9-10H2,1-6H3/b8-7+/t11-,12-,14+/m1/s1 |
| InChIKey | LRLBJEYDXPAFSC-YVYCFJEASA-N |
| XLogP | 2.25 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|