C13H19NO4 — CID 11149454
tert-butyl (1'S,4'S)-spiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate (PubChem CID 11149454) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is tert-butyl (1'S,4'S)-spiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate.
| Compound Name | tert-butyl (1'S,4'S)-spiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate |
|---|---|
| PubChem CID | 11149454 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | tert-butyl (1'S,4'S)-spiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C=C[C@H]1C1(C2)OCCO1 |
| InChI | InChI=1S/C13H19NO4/c1-12(2,3)18-11(15)14-9-4-5-10(14)13(8-9)16-6-7-17-13/h4-5,9-10H,6-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | OYKIRMHKXLMIDE-ZJUUUORDSA-N |
| XLogP | 1.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|