C19H35NO4 — CID 10860788
methyl 2-[(2S,5R)-5-[(Z,1S)-10-(dimethylamino)-1-hydroxydec-4-enyl]oxolan-2-yl]acetate (PubChem CID 10860788) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is methyl 2-[(2S,5R)-5-[(Z,1S)-10-(dimethylamino)-1-hydroxydec-4-enyl]oxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,5R)-5-[(Z,1S)-10-(dimethylamino)-1-hydroxydec-4-enyl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10860788 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | methyl 2-[(2S,5R)-5-[(Z,1S)-10-(dimethylamino)-1-hydroxydec-4-enyl]oxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@H]([C@@H](O)CC/C=C\CCCCCN(C)C)O1 |
| InChI | InChI=1S/C19H35NO4/c1-20(2)14-10-8-6-4-5-7-9-11-17(21)18-13-12-16(24-18)15-19(22)23-3/h5,7,16-18,21H,4,6,8-15H2,1-3H3/b7-5-/t16-,17-,18+/m0/s1 |
| InChIKey | KTYHQIGWLBBHEE-ZZGGFCQMSA-N |
| XLogP | 2.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|