C22H40O2Si — CID 10861442
(6Z)-6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hexan-2-one (PubChem CID 10861442) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (6Z)-6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hexan-2-one.
| Compound Name | (6Z)-6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hexan-2-one |
|---|---|
| PubChem CID | 10861442 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (6Z)-6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hexan-2-one |
| SMILES | CC(=O)CCC/C=C1/CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H40O2Si/c1-17(23)11-8-9-12-18-14-15-19-20(13-10-16-22(18,19)5)24-25(6,7)21(2,3)4/h12,19-20H,8-11,13-16H2,1-7H3/b18-12-/t19-,20-,22+/m0/s1 |
| InChIKey | FFZQIRHXIYIULA-LIOAMCABSA-N |
| XLogP | 6.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|