C12H10ClN5O7 — CID 10861625
2-[5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-oxopyridazin-4-yl]propanedinitrile (PubChem CID 10861625) has the molecular formula C12H10ClN5O7 and a molecular weight of 371.69 g/mol. Its IUPAC name is 2-[5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-oxopyridazin-4-yl]propanedinitrile.
| Compound Name | 2-[5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-oxopyridazin-4-yl]propanedinitrile |
|---|---|
| PubChem CID | 10861625 |
| Molecular Formula | C12H10ClN5O7 |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-[5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-oxopyridazin-4-yl]propanedinitrile |
| SMILES | N#CC(C#N)c1c([N+](=O)[O-])nn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)c1Cl |
| InChI | InChI=1S/C12H10ClN5O7/c13-7-6(4(1-14)2-15)10(18(23)24)16-17(11(7)22)12-9(21)8(20)5(3-19)25-12/h4-5,8-9,12,19-21H,3H2/t5-,8-,9-,12-/m1/s1 |
| InChIKey | UQTDIZLTVKCXFR-JJNLEZRASA-N |
| XLogP | -1.45 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|