C20H40O5Si — CID 10862053
methyl (3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2,2-dimethylpropanoyloxy)-3,5-dimethylhexanoate (PubChem CID 10862053) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is methyl (3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2,2-dimethylpropanoyloxy)-3,5-dimethylhexanoate.
| Compound Name | methyl (3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2,2-dimethylpropanoyloxy)-3,5-dimethylhexanoate |
|---|---|
| PubChem CID | 10862053 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | methyl (3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2,2-dimethylpropanoyloxy)-3,5-dimethylhexanoate |
| SMILES | COC(=O)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-14(12-16(21)23-9)17(25-26(10,11)20(6,7)8)15(2)13-24-18(22)19(3,4)5/h14-15,17H,12-13H2,1-11H3/t14-,15+,17-/m0/s1 |
| InChIKey | JQSFOXCYFBFRQP-UXLLHSPISA-N |
| XLogP | 4.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|