C11H9F3INO3S — CID 10862682
N-[(E)-3-(benzenesulfonyl)-2-iodoprop-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 10862682) has the molecular formula C11H9F3INO3S and a molecular weight of 419.16 g/mol. Its IUPAC name is N-[(E)-3-(benzenesulfonyl)-2-iodoprop-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E)-3-(benzenesulfonyl)-2-iodoprop-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10862682 |
| Molecular Formula | C11H9F3INO3S |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | N-[(E)-3-(benzenesulfonyl)-2-iodoprop-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC/C(I)=C\S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H9F3INO3S/c12-11(13,14)10(17)16-6-8(15)7-20(18,19)9-4-2-1-3-5-9/h1-5,7H,6H2,(H,16,17)/b8-7+ |
| InChIKey | YHNVTVMWTBWOFC-BQYQJAHWSA-N |
| XLogP | 2.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|