C26H32O6 — CID 10863104
(3R,4R,5S)-3-methoxy-5-[(E,1R)-4-methyl-1-(phenylmethoxymethoxy)pent-2-enyl]-4-phenylmethoxyoxolan-2-one (PubChem CID 10863104) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3R,4R,5S)-3-methoxy-5-[(E,1R)-4-methyl-1-(phenylmethoxymethoxy)pent-2-enyl]-4-phenylmethoxyoxolan-2-one.
| Compound Name | (3R,4R,5S)-3-methoxy-5-[(E,1R)-4-methyl-1-(phenylmethoxymethoxy)pent-2-enyl]-4-phenylmethoxyoxolan-2-one |
|---|---|
| PubChem CID | 10863104 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3R,4R,5S)-3-methoxy-5-[(E,1R)-4-methyl-1-(phenylmethoxymethoxy)pent-2-enyl]-4-phenylmethoxyoxolan-2-one |
| SMILES | CO[C@H]1C(=O)O[C@@H]([C@@H](/C=C/C(C)C)OCOCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-19(2)14-15-22(31-18-29-16-20-10-6-4-7-11-20)23-24(25(28-3)26(27)32-23)30-17-21-12-8-5-9-13-21/h4-15,19,22-25H,16-18H2,1-3H3/b15-14+/t22-,23+,24-,25-/m1/s1 |
| InChIKey | YYYBNUQGXXLRJF-FRCQDXQXSA-N |
| XLogP | 4.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|