C23H14ClN3O3 — CID 108633842
4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzonitrile (PubChem CID 108633842) has the molecular formula C23H14ClN3O3 and a molecular weight of 415.84 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108633842 |
| Molecular Formula | C23H14ClN3O3 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)cc3)C2c2ccncc2)cc1 |
| InChI | InChI=1S/C23H14ClN3O3/c24-17-5-3-16(4-6-17)21(28)19-20(15-9-11-26-12-10-15)27(23(30)22(19)29)18-7-1-14(13-25)2-8-18/h1-12,20,28H/b21-19- |
| InChIKey | CRABVFVADQCXEE-VZCXRCSSSA-N |
| XLogP | 4.23 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|