C15H20N2O4S — CID 10871045
(2S,3aS,7S)-2-(benzenesulfonyl)-3a,5,7-trimethyl-2,3,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyrazin-4-one (PubChem CID 10871045) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is (2S,3aS,7S)-2-(benzenesulfonyl)-3a,5,7-trimethyl-2,3,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyrazin-4-one.
| Compound Name | (2S,3aS,7S)-2-(benzenesulfonyl)-3a,5,7-trimethyl-2,3,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyrazin-4-one |
|---|---|
| PubChem CID | 10871045 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2S,3aS,7S)-2-(benzenesulfonyl)-3a,5,7-trimethyl-2,3,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyrazin-4-one |
| SMILES | C[C@H]1CN(C)C(=O)[C@]2(C)C[C@H](S(=O)(=O)c3ccccc3)ON12 |
| InChI | InChI=1S/C15H20N2O4S/c1-11-10-16(3)14(18)15(2)9-13(21-17(11)15)22(19,20)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/t11-,13-,15-/m0/s1 |
| InChIKey | AYOKKGHKNUHFSL-WHOFXGATSA-N |
| XLogP | 1.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |