C18H32O4Si — CID 10871545
[(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] propanoate (PubChem CID 10871545) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] propanoate.
| Compound Name | [(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] propanoate |
|---|---|
| PubChem CID | 10871545 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | [(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] propanoate |
| SMILES | C=CC[C@@H]1C=C[C@@H](OC(=O)CC)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H32O4Si/c1-8-10-14-11-12-15(22-17(19)9-2)16(21-14)13-20-23(6,7)18(3,4)5/h8,11-12,14-16H,1,9-10,13H2,2-7H3/t14-,15-,16-/m1/s1 |
| InChIKey | JZTJRFNLURKBOJ-BZUAXINKSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|