C20H24N2O4 — CID 10871986
(1S,2R,6S,9S,10R)-1,4-dimethyl-9-phenyl-10-propan-2-yl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione (PubChem CID 10871986) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1S,2R,6S,9S,10R)-1,4-dimethyl-9-phenyl-10-propan-2-yl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione.
| Compound Name | (1S,2R,6S,9S,10R)-1,4-dimethyl-9-phenyl-10-propan-2-yl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
|---|---|
| PubChem CID | 10871986 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (1S,2R,6S,9S,10R)-1,4-dimethyl-9-phenyl-10-propan-2-yl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
| SMILES | CC(C)[C@H]1OC(=O)[C@]2(C)[C@@H]3C(=O)N(C)C(=O)[C@@H]3CN2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-11(2)16-15(12-8-6-5-7-9-12)22-10-13-14(18(24)21(4)17(13)23)20(22,3)19(25)26-16/h5-9,11,13-16H,10H2,1-4H3/t13-,14+,15+,16-,20+/m1/s1 |
| InChIKey | NRJSWQUKRPHIFT-QVTQBDIJSA-N |
| XLogP | 1.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|