C28H29F3N2O6 — CID 24982497
methyl (3aS,4S,9aS,9bR)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24982497) has the molecular formula C28H29F3N2O6 and a molecular weight of 546.54 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aS,4S,9aS,9bR)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24982497 |
| Molecular Formula | C28H29F3N2O6 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](c3ccc(-c4ccccc4)cc3)N3CCCC[C@@]3(C(=O)OC)[C@@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28N2O4.C2HF3O2/c1-3-27-23(29)20-21(24(27)30)26(25(31)32-2)15-7-8-16-28(26)22(20)19-13-11-18(12-14-19)17-9-5-4-6-10-17;3-2(4,5)1(6)7/h4-6,9-14,20-22H,3,7-8,15-16H2,1-2H3;(H,6,7)/t20-,21-,22+,26-;/m0./s1 |
| InChIKey | CNKAZAKWHJWMPF-FKHNWUCXSA-N |
| XLogP | 4.06 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|