C27H28N2O7 — CID 24981403
methyl (3aS,4S,8aS,8bR)-4-[4-(1,3-benzodioxol-5-yl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate (PubChem CID 24981403) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is methyl (3aS,4S,8aS,8bR)-4-[4-(1,3-benzodioxol-5-yl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate.
| Compound Name | methyl (3aS,4S,8aS,8bR)-4-[4-(1,3-benzodioxol-5-yl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate |
|---|---|
| PubChem CID | 24981403 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | methyl (3aS,4S,8aS,8bR)-4-[4-(1,3-benzodioxol-5-yl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](c3ccc(-c4ccc5c(c4)OCO5)c(OC)c3)N3CCC[C@@]3(C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C27H28N2O7/c1-4-28-24(30)21-22(25(28)31)27(26(32)34-3)10-5-11-29(27)23(21)16-6-8-17(19(13-16)33-2)15-7-9-18-20(12-15)36-14-35-18/h6-9,12-13,21-23H,4-5,10-11,14H2,1-3H3/t21-,22-,23+,27-/m0/s1 |
| InChIKey | IISGOVPHVZRYLO-TZKYFUQOSA-N |
| XLogP | 2.77 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|