C28H29F3N2O8 — CID 24981470
methyl (3aR,4S,8aS,8bS)-4-[3-methoxy-4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981470) has the molecular formula C28H29F3N2O8 and a molecular weight of 578.54 g/mol. Its IUPAC name is methyl (3aR,4S,8aS,8bS)-4-[3-methoxy-4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aR,4S,8aS,8bS)-4-[3-methoxy-4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981470 |
| Molecular Formula | C28H29F3N2O8 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl (3aR,4S,8aS,8bS)-4-[3-methoxy-4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@]12CCCN1[C@H](c1ccc(-c3ccc(OC)cc3)c(OC)c1)[C@@H]1C(=O)N(C)C(=O)[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28N2O6.C2HF3O2/c1-27-23(29)20-21(24(27)30)26(25(31)34-4)12-5-13-28(26)22(20)16-8-11-18(19(14-16)33-3)15-6-9-17(32-2)10-7-15;3-2(4,5)1(6)7/h6-11,14,20-22H,5,12-13H2,1-4H3;(H,6,7)/t20-,21-,22-,26+;/m1./s1 |
| InChIKey | QXLCHYYYUYXGIN-CPNWZACFSA-N |
| XLogP | 3.30 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|