C14H18N2O8S — CID 10872446
2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethoxy]ethyl]amino]acetic acid (PubChem CID 10872446) has the molecular formula C14H18N2O8S and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethoxy]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethoxy]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 10872446 |
| Molecular Formula | C14H18N2O8S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethoxy]ethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(CCOC(=O)CN(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O8S/c15-25(22,23)11-3-1-10(2-4-11)5-6-24-14(21)9-16(7-12(17)18)8-13(19)20/h1-4H,5-9H2,(H,17,18)(H,19,20)(H2,15,22,23) |
| InChIKey | NNIIWZOHYYFNCQ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |