C19H28N2O2 — CID 108726422
2-ethylhexyl N-(2-indol-1-ylethyl)carbamate (PubChem CID 108726422) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-ethylhexyl N-(2-indol-1-ylethyl)carbamate.
| Compound Name | 2-ethylhexyl N-(2-indol-1-ylethyl)carbamate |
|---|---|
| PubChem CID | 108726422 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-ethylhexyl N-(2-indol-1-ylethyl)carbamate |
| SMILES | CCCCC(CC)COC(=O)NCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H28N2O2/c1-3-5-8-16(4-2)15-23-19(22)20-12-14-21-13-11-17-9-6-7-10-18(17)21/h6-7,9-11,13,16H,3-5,8,12,14-15H2,1-2H3,(H,20,22) |
| InChIKey | CKQSCAWQCXYKSA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |