C17H29IOSi — CID 10873143
tert-butyl-[[1-[(Z)-4-iodobut-3-enyl]cyclohexa-2,5-dien-1-yl]methoxy]-dimethylsilane (PubChem CID 10873143) has the molecular formula C17H29IOSi and a molecular weight of 404.41 g/mol. Its IUPAC name is tert-butyl-[[1-[(Z)-4-iodobut-3-enyl]cyclohexa-2,5-dien-1-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[1-[(Z)-4-iodobut-3-enyl]cyclohexa-2,5-dien-1-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10873143 |
| Molecular Formula | C17H29IOSi |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | tert-butyl-[[1-[(Z)-4-iodobut-3-enyl]cyclohexa-2,5-dien-1-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CC/C=C\I)C=CCC=C1 |
| InChI | InChI=1S/C17H29IOSi/c1-16(2,3)20(4,5)19-15-17(13-9-10-14-18)11-7-6-8-12-17/h7-8,10-12,14H,6,9,13,15H2,1-5H3/b14-10- |
| InChIKey | KZPMOAVOUUYPTP-UVTDQMKNSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|