C12H18OSi — CID 69410251
1-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane (PubChem CID 69410251) has the molecular formula C12H18OSi and a molecular weight of 206.36 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane.
| Compound Name | 1-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 69410251 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)OCC12C=CC(C=C1)C2 |
| InChI | InChI=1S/C12H18OSi/c1-4-14(2,3)13-10-12-7-5-11(9-12)6-8-12/h4-8,11H,1,9-10H2,2-3H3 |
| InChIKey | PWSOMYFHESTWLV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|