C19H20F2N2O2S2 — CID 10873290
(2E)-3-(3,5-difluorophenyl)-N-[2-[(2,6-dimethylphenyl)disulfanyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 10873290) has the molecular formula C19H20F2N2O2S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is (2E)-3-(3,5-difluorophenyl)-N-[2-[(2,6-dimethylphenyl)disulfanyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(3,5-difluorophenyl)-N-[2-[(2,6-dimethylphenyl)disulfanyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 10873290 |
| Molecular Formula | C19H20F2N2O2S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2E)-3-(3,5-difluorophenyl)-N-[2-[(2,6-dimethylphenyl)disulfanyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | Cc1cccc(C)c1SSCCNC(=O)/C(Cc1cc(F)cc(F)c1)=N/O |
| InChI | InChI=1S/C19H20F2N2O2S2/c1-12-4-3-5-13(2)18(12)27-26-7-6-22-19(24)17(23-25)10-14-8-15(20)11-16(21)9-14/h3-5,8-9,11,25H,6-7,10H2,1-2H3,(H,22,24)/b23-17+ |
| InChIKey | JAZDFJOTLKXPCW-HAVVHWLPSA-N |
| XLogP | 4.51 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|