C23H23ClN2O7 — CID 108735224
6-chloro-1'-(4,5-dimethoxy-2-nitrobenzoyl)-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735224) has the molecular formula C23H23ClN2O7 and a molecular weight of 474.90 g/mol. Its IUPAC name is 6-chloro-1'-(4,5-dimethoxy-2-nitrobenzoyl)-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-(4,5-dimethoxy-2-nitrobenzoyl)-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735224 |
| Molecular Formula | C23H23ClN2O7 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 6-chloro-1'-(4,5-dimethoxy-2-nitrobenzoyl)-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)c(C)cc2O3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H23ClN2O7/c1-13-8-19-15(9-16(13)24)18(27)12-23(33-19)4-6-25(7-5-23)22(28)14-10-20(31-2)21(32-3)11-17(14)26(29)30/h8-11H,4-7,12H2,1-3H3 |
| InChIKey | DTGRCOXTXNAUFU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|