C16H14N4O5S — CID 108737178
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108737178) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108737178 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1nc(C(C)NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cs1 |
| InChI | InChI=1S/C16H14N4O5S/c1-8(13-7-26-9(2)18-13)17-14(21)6-19-15(22)11-4-3-10(20(24)25)5-12(11)16(19)23/h3-5,7-8H,6H2,1-2H3,(H,17,21) |
| InChIKey | NIZUXFQLUBQHRR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|