C20H15ClN4O5S — CID 4678981
N-[4-(6-chlorohepta-1,3,5-trien-3-yl)-1,3-thiazol-2-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 4678981) has the molecular formula C20H15ClN4O5S and a molecular weight of 458.88 g/mol. Its IUPAC name is N-[4-(6-chlorohepta-1,3,5-trien-3-yl)-1,3-thiazol-2-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[4-(6-chlorohepta-1,3,5-trien-3-yl)-1,3-thiazol-2-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 4678981 |
| Molecular Formula | C20H15ClN4O5S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-[4-(6-chlorohepta-1,3,5-trien-3-yl)-1,3-thiazol-2-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | C=CC(=CC=C(C)Cl)c1csc(NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)n1 |
| InChI | InChI=1S/C20H15ClN4O5S/c1-3-12(5-4-11(2)21)16-10-31-20(22-16)23-17(26)9-24-18(27)14-7-6-13(25(29)30)8-15(14)19(24)28/h3-8,10H,1,9H2,2H3,(H,22,23,26) |
| InChIKey | KXBQZFRUNZAZIG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|