C27H56O3Si3 — CID 10874920
tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenylhex-5-ynoxy]-dimethylsilane (PubChem CID 10874920) has the molecular formula C27H56O3Si3 and a molecular weight of 513.00 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenylhex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenylhex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10874920 |
| Molecular Formula | C27H56O3Si3 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenylhex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O3Si3/c1-18-20-24(30-33(16,17)27(9,10)11)22(21-28-31(12,13)25(3,4)5)23(19-2)29-32(14,15)26(6,7)8/h1,19,22-24H,2,20-21H2,3-17H3/t22-,23-,24-/m1/s1 |
| InChIKey | OYIHFIDUMOHKIB-WXFUMESZSA-N |
| XLogP | 8.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|